C21H23O4- — CID 19421516
(E)-3-[3-(3,4-dipropoxyphenyl)phenyl]prop-2-enoate (PubChem CID 19421516) has the molecular formula C21H23O4- and a molecular weight of 339.41 g/mol. Its IUPAC name is (E)-3-[3-(3,4-dipropoxyphenyl)phenyl]prop-2-enoate.
| Compound Name | (E)-3-[3-(3,4-dipropoxyphenyl)phenyl]prop-2-enoate |
|---|---|
| PubChem CID | 19421516 |
| Molecular Formula | C21H23O4- |
| Molecular Weight | 339.41 g/mol |
| Exact Mass | 339.16 |
| IUPAC Name | (E)-3-[3-(3,4-dipropoxyphenyl)phenyl]prop-2-enoate |
| SMILES | CCCOc1ccc(-c2cccc(/C=C/C(=O)[O-])c2)cc1OCCC |
| InChI | InChI=1S/C21H24O4/c1-3-12-24-19-10-9-18(15-20(19)25-13-4-2)17-7-5-6-16(14-17)8-11-21(22)23/h5-11,14-15H,3-4,12-13H2,1-2H3,(H,22,23)/p-1/b11-8+ |
| InChIKey | QCWJRTNZIYGKFD-DHZHZOJOSA-M |
| XLogP | 3.69 |
| TPSA | 58.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.41 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|