C19H27NO4 — CID 39102516
(E)-3-[4-[2-(azepan-1-ium-1-yl)ethoxy]-3-ethoxyphenyl]prop-2-enoate (PubChem CID 39102516) has the molecular formula C19H27NO4 and a molecular weight of 333.43 g/mol. Its IUPAC name is (E)-3-[4-[2-(azepan-1-ium-1-yl)ethoxy]-3-ethoxyphenyl]prop-2-enoate.
| Compound Name | (E)-3-[4-[2-(azepan-1-ium-1-yl)ethoxy]-3-ethoxyphenyl]prop-2-enoate |
|---|---|
| PubChem CID | 39102516 |
| Molecular Formula | C19H27NO4 |
| Molecular Weight | 333.43 g/mol |
| Exact Mass | 333.19 |
| IUPAC Name | (E)-3-[4-[2-(azepan-1-ium-1-yl)ethoxy]-3-ethoxyphenyl]prop-2-enoate |
| SMILES | CCOc1cc(/C=C/C(=O)[O-])ccc1OCC[NH+]1CCCCCC1 |
| InChI | InChI=1S/C19H27NO4/c1-2-23-18-15-16(8-10-19(21)22)7-9-17(18)24-14-13-20-11-5-3-4-6-12-20/h7-10,15H,2-6,11-14H2,1H3,(H,21,22)/b10-8+ |
| InChIKey | NQSWMXKCENJNQZ-CSKARUKUSA-N |
| XLogP | 0.69 |
| TPSA | 63.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.43 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|