C21H25NO3 — CID 39102169
(E)-3-[2-[2-(azepan-1-ium-1-yl)ethoxy]naphthalen-1-yl]prop-2-enoate (PubChem CID 39102169) has the molecular formula C21H25NO3 and a molecular weight of 339.44 g/mol. Its IUPAC name is (E)-3-[2-[2-(azepan-1-ium-1-yl)ethoxy]naphthalen-1-yl]prop-2-enoate.
| Compound Name | (E)-3-[2-[2-(azepan-1-ium-1-yl)ethoxy]naphthalen-1-yl]prop-2-enoate |
|---|---|
| PubChem CID | 39102169 |
| Molecular Formula | C21H25NO3 |
| Molecular Weight | 339.44 g/mol |
| Exact Mass | 339.18 |
| IUPAC Name | (E)-3-[2-[2-(azepan-1-ium-1-yl)ethoxy]naphthalen-1-yl]prop-2-enoate |
| SMILES | O=C([O-])/C=C/c1c(OCC[NH+]2CCCCCC2)ccc2ccccc12 |
| InChI | InChI=1S/C21H25NO3/c23-21(24)12-10-19-18-8-4-3-7-17(18)9-11-20(19)25-16-15-22-13-5-1-2-6-14-22/h3-4,7-12H,1-2,5-6,13-16H2,(H,23,24)/b12-10+ |
| InChIKey | RFBGHSLUIMOFTJ-ZRDIBKRKSA-N |
| XLogP | 1.44 |
| TPSA | 53.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.44 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|