C25H37N3O3 — CID 142665333
4-[[4-(4-aminophenyl)piperazin-1-yl]methyl]-2,6-dibutoxyphenol (PubChem CID 142665333) has the molecular formula C25H37N3O3 and a molecular weight of 427.59 g/mol. Its IUPAC name is 4-[[4-(4-aminophenyl)piperazin-1-yl]methyl]-2,6-dibutoxyphenol.
| Compound Name | 4-[[4-(4-aminophenyl)piperazin-1-yl]methyl]-2,6-dibutoxyphenol |
|---|---|
| PubChem CID | 142665333 |
| Molecular Formula | C25H37N3O3 |
| Molecular Weight | 427.59 g/mol |
| Exact Mass | 427.28 |
| IUPAC Name | 4-[[4-(4-aminophenyl)piperazin-1-yl]methyl]-2,6-dibutoxyphenol |
| SMILES | CCCCOc1cc(CN2CCN(c3ccc(N)cc3)CC2)cc(OCCCC)c1O |
| InChI | InChI=1S/C25H37N3O3/c1-3-5-15-30-23-17-20(18-24(25(23)29)31-16-6-4-2)19-27-11-13-28(14-12-27)22-9-7-21(26)8-10-22/h7-10,17-18,29H,3-6,11-16,19,26H2,1-2H3 |
| InChIKey | IEYGVYSJHLSAKD-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 71.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.59 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|