C19H19F6N3 — CID 142814908
4-[4-[[3,5-bis(trifluoromethyl)phenyl]methyl]piperazin-1-yl]aniline (PubChem CID 142814908) has the molecular formula C19H19F6N3 and a molecular weight of 403.37 g/mol. Its IUPAC name is 4-[4-[[3,5-bis(trifluoromethyl)phenyl]methyl]piperazin-1-yl]aniline.
| Compound Name | 4-[4-[[3,5-bis(trifluoromethyl)phenyl]methyl]piperazin-1-yl]aniline |
|---|---|
| PubChem CID | 142814908 |
| Molecular Formula | C19H19F6N3 |
| Molecular Weight | 403.37 g/mol |
| Exact Mass | 403.15 |
| IUPAC Name | 4-[4-[[3,5-bis(trifluoromethyl)phenyl]methyl]piperazin-1-yl]aniline |
| SMILES | Nc1ccc(N2CCN(Cc3cc(C(F)(F)F)cc(C(F)(F)F)c3)CC2)cc1 |
| InChI | InChI=1S/C19H19F6N3/c20-18(21,22)14-9-13(10-15(11-14)19(23,24)25)12-27-5-7-28(8-6-27)17-3-1-16(26)2-4-17/h1-4,9-11H,5-8,12,26H2 |
| InChIKey | ALVUKISEOREITG-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 32.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.37 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|