C18H20F3N3 — CID 135127202
3-[[4-[4-(trifluoromethyl)phenyl]piperazin-1-yl]methyl]aniline (PubChem CID 135127202) has the molecular formula C18H20F3N3 and a molecular weight of 335.37 g/mol. Its IUPAC name is 3-[[4-[4-(trifluoromethyl)phenyl]piperazin-1-yl]methyl]aniline.
| Compound Name | 3-[[4-[4-(trifluoromethyl)phenyl]piperazin-1-yl]methyl]aniline |
|---|---|
| PubChem CID | 135127202 |
| Molecular Formula | C18H20F3N3 |
| Molecular Weight | 335.37 g/mol |
| Exact Mass | 335.16 |
| IUPAC Name | 3-[[4-[4-(trifluoromethyl)phenyl]piperazin-1-yl]methyl]aniline |
| SMILES | Nc1cccc(CN2CCN(c3ccc(C(F)(F)F)cc3)CC2)c1 |
| InChI | InChI=1S/C18H20F3N3/c19-18(20,21)15-4-6-17(7-5-15)24-10-8-23(9-11-24)13-14-2-1-3-16(22)12-14/h1-7,12H,8-11,13,22H2 |
| InChIKey | FYOIPYDEBHZTFZ-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 32.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.37 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|