C24H26F3N3O4 — CID 135127201
dimethyl 2-[[3-[[4-[4-(trifluoromethyl)phenyl]piperazin-1-yl]methyl]anilino]methylidene]propanedioate (PubChem CID 135127201) has the molecular formula C24H26F3N3O4 and a molecular weight of 477.48 g/mol. Its IUPAC name is dimethyl 2-[[3-[[4-[4-(trifluoromethyl)phenyl]piperazin-1-yl]methyl]anilino]methylidene]propanedioate.
| Compound Name | dimethyl 2-[[3-[[4-[4-(trifluoromethyl)phenyl]piperazin-1-yl]methyl]anilino]methylidene]propanedioate |
|---|---|
| PubChem CID | 135127201 |
| Molecular Formula | C24H26F3N3O4 |
| Molecular Weight | 477.48 g/mol |
| Exact Mass | 477.19 |
| IUPAC Name | dimethyl 2-[[3-[[4-[4-(trifluoromethyl)phenyl]piperazin-1-yl]methyl]anilino]methylidene]propanedioate |
| SMILES | COC(=O)C(=CNc1cccc(CN2CCN(c3ccc(C(F)(F)F)cc3)CC2)c1)C(=O)OC |
| InChI | InChI=1S/C24H26F3N3O4/c1-33-22(31)21(23(32)34-2)15-28-19-5-3-4-17(14-19)16-29-10-12-30(13-11-29)20-8-6-18(7-9-20)24(25,26)27/h3-9,14-15,28H,10-13,16H2,1-2H3 |
| InChIKey | FBVDDWGQXUUKBI-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 71.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.48 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|