C42H60N4O2S — CID 22024902
N'-[4-[4-[(E)-3-[4-hydroxy-3,5-di(nonyl)phenyl]prop-2-enoyl]piperazin-1-yl]phenyl]thiophene-2-carboximidamide (PubChem CID 22024902) has the molecular formula C42H60N4O2S and a molecular weight of 685.04 g/mol. Its IUPAC name is N'-[4-[4-[(E)-3-[4-hydroxy-3,5-di(nonyl)phenyl]prop-2-enoyl]piperazin-1-yl]phenyl]thiophene-2-carboximidamide.
| Compound Name | N'-[4-[4-[(E)-3-[4-hydroxy-3,5-di(nonyl)phenyl]prop-2-enoyl]piperazin-1-yl]phenyl]thiophene-2-carboximidamide |
|---|---|
| PubChem CID | 22024902 |
| Molecular Formula | C42H60N4O2S |
| Molecular Weight | 685.04 g/mol |
| Exact Mass | 684.44 |
| IUPAC Name | N'-[4-[4-[(E)-3-[4-hydroxy-3,5-di(nonyl)phenyl]prop-2-enoyl]piperazin-1-yl]phenyl]thiophene-2-carboximidamide |
| SMILES | CCCCCCCCCc1cc(/C=C/C(=O)N2CCN(c3ccc(/N=C(\N)c4cccs4)cc3)CC2)cc(CCCCCCCCC)c1O |
| InChI | InChI=1S/C42H60N4O2S/c1-3-5-7-9-11-13-15-18-35-32-34(33-36(41(35)48)19-16-14-12-10-8-6-4-2)21-26-40(47)46-29-27-45(28-30-46)38-24-22-37(23-25-38)44-42(43)39-20-17-31-49-39/h17,20-26,31-33,48H,3-16,18-19,27-30H2,1-2H3,(H2,43,44)/b26-21+ |
| InChIKey | RANNJXDXXKPHGI-YYADALCUSA-N |
| XLogP | 10.44 |
| TPSA | 82.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 685.04 |
| LogP ≤ 5 | 10.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|