C23H35NO2 — CID 57113066
1-(azepan-1-yl)-3-(3,5-ditert-butyl-4-hydroxyphenyl)prop-2-en-1-one (PubChem CID 57113066) has the molecular formula C23H35NO2 and a molecular weight of 357.54 g/mol. Its IUPAC name is 1-(azepan-1-yl)-3-(3,5-ditert-butyl-4-hydroxyphenyl)prop-2-en-1-one.
| Compound Name | 1-(azepan-1-yl)-3-(3,5-ditert-butyl-4-hydroxyphenyl)prop-2-en-1-one |
|---|---|
| PubChem CID | 57113066 |
| Molecular Formula | C23H35NO2 |
| Molecular Weight | 357.54 g/mol |
| Exact Mass | 357.27 |
| IUPAC Name | 1-(azepan-1-yl)-3-(3,5-ditert-butyl-4-hydroxyphenyl)prop-2-en-1-one |
| SMILES | CC(C)(C)c1cc(C=CC(=O)N2CCCCCC2)cc(C(C)(C)C)c1O |
| InChI | InChI=1S/C23H35NO2/c1-22(2,3)18-15-17(16-19(21(18)26)23(4,5)6)11-12-20(25)24-13-9-7-8-10-14-24/h11-12,15-16,26H,7-10,13-14H2,1-6H3 |
| InChIKey | QRMSATSBGUYQNQ-UHFFFAOYSA-N |
| XLogP | 5.40 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.54 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|