C21H21NO3S — CID 27901791
N-[4-(2-methoxyphenoxy)phenyl]-4-thiophen-2-ylbutanamide (PubChem CID 27901791) has the molecular formula C21H21NO3S and a molecular weight of 367.47 g/mol. Its IUPAC name is N-[4-(2-methoxyphenoxy)phenyl]-4-thiophen-2-ylbutanamide.
| Compound Name | N-[4-(2-methoxyphenoxy)phenyl]-4-thiophen-2-ylbutanamide |
|---|---|
| PubChem CID | 27901791 |
| Molecular Formula | C21H21NO3S |
| Molecular Weight | 367.47 g/mol |
| Exact Mass | 367.12 |
| IUPAC Name | N-[4-(2-methoxyphenoxy)phenyl]-4-thiophen-2-ylbutanamide |
| SMILES | COc1ccccc1Oc1ccc(NC(=O)CCCc2cccs2)cc1 |
| InChI | InChI=1S/C21H21NO3S/c1-24-19-8-2-3-9-20(19)25-17-13-11-16(12-14-17)22-21(23)10-4-6-18-7-5-15-26-18/h2-3,5,7-9,11-15H,4,6,10H2,1H3,(H,22,23) |
| InChIKey | ISNMLMPVCBXQKU-UHFFFAOYSA-N |
| XLogP | 5.51 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.47 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |