C14H19Cl2N3OS — CID 70132259
N'-[2-methoxy-5-(methylaminomethyl)phenyl]thiophene-2-carboximidamide;dihydrochloride (PubChem CID 70132259) has the molecular formula C14H19Cl2N3OS and a molecular weight of 348.30 g/mol. Its IUPAC name is N'-[2-methoxy-5-(methylaminomethyl)phenyl]thiophene-2-carboximidamide;dihydrochloride.
| Compound Name | N'-[2-methoxy-5-(methylaminomethyl)phenyl]thiophene-2-carboximidamide;dihydrochloride |
|---|---|
| PubChem CID | 70132259 |
| Molecular Formula | C14H19Cl2N3OS |
| Molecular Weight | 348.30 g/mol |
| Exact Mass | 347.06 |
| IUPAC Name | N'-[2-methoxy-5-(methylaminomethyl)phenyl]thiophene-2-carboximidamide;dihydrochloride |
| SMILES | CNCc1ccc(OC)c(/N=C(\N)c2cccs2)c1.Cl.Cl |
| InChI | InChI=1S/C14H17N3OS.2ClH/c1-16-9-10-5-6-12(18-2)11(8-10)17-14(15)13-4-3-7-19-13;;/h3-8,16H,9H2,1-2H3,(H2,15,17);2*1H |
| InChIKey | JWCJIKOOZWEOBT-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 59.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.30 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|