C15H16N4S — CID 22225903
N'-[4-[[cyanomethyl(methyl)amino]methyl]phenyl]thiophene-2-carboximidamide (PubChem CID 22225903) has the molecular formula C15H16N4S and a molecular weight of 284.39 g/mol. Its IUPAC name is N'-[4-[[cyanomethyl(methyl)amino]methyl]phenyl]thiophene-2-carboximidamide.
| Compound Name | N'-[4-[[cyanomethyl(methyl)amino]methyl]phenyl]thiophene-2-carboximidamide |
|---|---|
| PubChem CID | 22225903 |
| Molecular Formula | C15H16N4S |
| Molecular Weight | 284.39 g/mol |
| Exact Mass | 284.11 |
| IUPAC Name | N'-[4-[[cyanomethyl(methyl)amino]methyl]phenyl]thiophene-2-carboximidamide |
| SMILES | CN(CC#N)Cc1ccc(/N=C(\N)c2cccs2)cc1 |
| InChI | InChI=1S/C15H16N4S/c1-19(9-8-16)11-12-4-6-13(7-5-12)18-15(17)14-3-2-10-20-14/h2-7,10H,9,11H2,1H3,(H2,17,18) |
| InChIKey | LWIPLNHFRXHPKZ-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 65.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.39 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|