C16H18F3N3S — CID 10193503
N'-[4-[(4,4,4-trifluorobutan-2-ylamino)methyl]phenyl]thiophene-2-carboximidamide (PubChem CID 10193503) has the molecular formula C16H18F3N3S and a molecular weight of 341.40 g/mol. Its IUPAC name is N'-[4-[(4,4,4-trifluorobutan-2-ylamino)methyl]phenyl]thiophene-2-carboximidamide.
| Compound Name | N'-[4-[(4,4,4-trifluorobutan-2-ylamino)methyl]phenyl]thiophene-2-carboximidamide |
|---|---|
| PubChem CID | 10193503 |
| Molecular Formula | C16H18F3N3S |
| Molecular Weight | 341.40 g/mol |
| Exact Mass | 341.12 |
| IUPAC Name | N'-[4-[(4,4,4-trifluorobutan-2-ylamino)methyl]phenyl]thiophene-2-carboximidamide |
| SMILES | CC(CC(F)(F)F)NCc1ccc(/N=C(\N)c2cccs2)cc1 |
| InChI | InChI=1S/C16H18F3N3S/c1-11(9-16(17,18)19)21-10-12-4-6-13(7-5-12)22-15(20)14-3-2-8-23-14/h2-8,11,21H,9-10H2,1H3,(H2,20,22) |
| InChIKey | PVAGOPXITYACTJ-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 50.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.40 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|