C19H18N4S2 — CID 54298600
N'-[4-[[(2-sulfanylanilino)methylideneamino]methyl]phenyl]thiophene-2-carboximidamide (PubChem CID 54298600) has the molecular formula C19H18N4S2 and a molecular weight of 366.52 g/mol. Its IUPAC name is N'-[4-[[(2-sulfanylanilino)methylideneamino]methyl]phenyl]thiophene-2-carboximidamide.
| Compound Name | N'-[4-[[(2-sulfanylanilino)methylideneamino]methyl]phenyl]thiophene-2-carboximidamide |
|---|---|
| PubChem CID | 54298600 |
| Molecular Formula | C19H18N4S2 |
| Molecular Weight | 366.52 g/mol |
| Exact Mass | 366.10 |
| IUPAC Name | N'-[4-[[(2-sulfanylanilino)methylideneamino]methyl]phenyl]thiophene-2-carboximidamide |
| SMILES | N/C(=N\c1ccc(C/N=C/Nc2ccccc2S)cc1)c1cccs1 |
| InChI | InChI=1S/C19H18N4S2/c20-19(18-6-3-11-25-18)23-15-9-7-14(8-10-15)12-21-13-22-16-4-1-2-5-17(16)24/h1-11,13,24H,12H2,(H2,20,23)(H,21,22) |
| InChIKey | SCOBOBKVBSWMME-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 62.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.52 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|