C21H23N3O2S — CID 10156689
N'-[3-[[2-hydroxyethyl(methyl)amino]methyl]-4-phenoxyphenyl]thiophene-2-carboximidamide (PubChem CID 10156689) has the molecular formula C21H23N3O2S and a molecular weight of 381.50 g/mol. Its IUPAC name is N'-[3-[[2-hydroxyethyl(methyl)amino]methyl]-4-phenoxyphenyl]thiophene-2-carboximidamide.
| Compound Name | N'-[3-[[2-hydroxyethyl(methyl)amino]methyl]-4-phenoxyphenyl]thiophene-2-carboximidamide |
|---|---|
| PubChem CID | 10156689 |
| Molecular Formula | C21H23N3O2S |
| Molecular Weight | 381.50 g/mol |
| Exact Mass | 381.15 |
| IUPAC Name | N'-[3-[[2-hydroxyethyl(methyl)amino]methyl]-4-phenoxyphenyl]thiophene-2-carboximidamide |
| SMILES | CN(CCO)Cc1cc(/N=C(\N)c2cccs2)ccc1Oc1ccccc1 |
| InChI | InChI=1S/C21H23N3O2S/c1-24(11-12-25)15-16-14-17(23-21(22)20-8-5-13-27-20)9-10-19(16)26-18-6-3-2-4-7-18/h2-10,13-14,25H,11-12,15H2,1H3,(H2,22,23) |
| InChIKey | SDKBBBLZYNBARJ-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 71.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.50 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|