C20H26N4S — CID 89329677
N'-[3-(1-aminoheptan-4-yl)-1H-indol-6-yl]thiophene-2-carboximidamide (PubChem CID 89329677) has the molecular formula C20H26N4S and a molecular weight of 354.52 g/mol. Its IUPAC name is N'-[3-(1-aminoheptan-4-yl)-1H-indol-6-yl]thiophene-2-carboximidamide.
| Compound Name | N'-[3-(1-aminoheptan-4-yl)-1H-indol-6-yl]thiophene-2-carboximidamide |
|---|---|
| PubChem CID | 89329677 |
| Molecular Formula | C20H26N4S |
| Molecular Weight | 354.52 g/mol |
| Exact Mass | 354.19 |
| IUPAC Name | N'-[3-(1-aminoheptan-4-yl)-1H-indol-6-yl]thiophene-2-carboximidamide |
| SMILES | CCCC(CCCN)c1c[nH]c2cc(/N=C(\N)c3cccs3)ccc12 |
| InChI | InChI=1S/C20H26N4S/c1-2-5-14(6-3-10-21)17-13-23-18-12-15(8-9-16(17)18)24-20(22)19-7-4-11-25-19/h4,7-9,11-14,23H,2-3,5-6,10,21H2,1H3,(H2,22,24) |
| InChIKey | IKMKINULLMBAOQ-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 80.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.52 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|