C19H21N3S — CID 163470170
N'-[3-(cyclohexen-1-yl)-2,3-dihydro-1H-indol-5-yl]thiophene-2-carboximidamide (PubChem CID 163470170) has the molecular formula C19H21N3S and a molecular weight of 323.47 g/mol. Its IUPAC name is N'-[3-(cyclohexen-1-yl)-2,3-dihydro-1H-indol-5-yl]thiophene-2-carboximidamide.
| Compound Name | N'-[3-(cyclohexen-1-yl)-2,3-dihydro-1H-indol-5-yl]thiophene-2-carboximidamide |
|---|---|
| PubChem CID | 163470170 |
| Molecular Formula | C19H21N3S |
| Molecular Weight | 323.47 g/mol |
| Exact Mass | 323.15 |
| IUPAC Name | N'-[3-(cyclohexen-1-yl)-2,3-dihydro-1H-indol-5-yl]thiophene-2-carboximidamide |
| SMILES | N/C(=N\c1ccc2c(c1)C(C1=CCCCC1)CN2)c1cccs1 |
| InChI | InChI=1S/C19H21N3S/c20-19(18-7-4-10-23-18)22-14-8-9-17-15(11-14)16(12-21-17)13-5-2-1-3-6-13/h4-5,7-11,16,21H,1-3,6,12H2,(H2,20,22) |
| InChIKey | BVXHKZKVVBJLQV-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 50.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.47 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|