C15H17NO2 — CID 70793484
3-(cyclohexen-1-yl)-2,3-dihydro-1H-indole-6-carboxylic acid (PubChem CID 70793484) has the molecular formula C15H17NO2 and a molecular weight of 243.31 g/mol. Its IUPAC name is 3-(cyclohexen-1-yl)-2,3-dihydro-1H-indole-6-carboxylic acid.
| Compound Name | 3-(cyclohexen-1-yl)-2,3-dihydro-1H-indole-6-carboxylic acid |
|---|---|
| PubChem CID | 70793484 |
| Molecular Formula | C15H17NO2 |
| Molecular Weight | 243.31 g/mol |
| Exact Mass | 243.13 |
| IUPAC Name | 3-(cyclohexen-1-yl)-2,3-dihydro-1H-indole-6-carboxylic acid |
| SMILES | O=C(O)c1ccc2c(c1)NCC2C1=CCCCC1 |
| InChI | InChI=1S/C15H17NO2/c17-15(18)11-6-7-12-13(9-16-14(12)8-11)10-4-2-1-3-5-10/h4,6-8,13,16H,1-3,5,9H2,(H,17,18) |
| InChIKey | LMELEUXRKHXGPB-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.31 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|