C21H26N4O2S — CID 67492758
4-[7-[[amino(thiophen-2-yl)methylidene]amino]-2,3,4,5-tetrahydro-1-benzazepin-1-yl]piperidine-1-carboxylic acid (PubChem CID 67492758) has the molecular formula C21H26N4O2S and a molecular weight of 398.53 g/mol. Its IUPAC name is 4-[7-[[amino(thiophen-2-yl)methylidene]amino]-2,3,4,5-tetrahydro-1-benzazepin-1-yl]piperidine-1-carboxylic acid.
| Compound Name | 4-[7-[[amino(thiophen-2-yl)methylidene]amino]-2,3,4,5-tetrahydro-1-benzazepin-1-yl]piperidine-1-carboxylic acid |
|---|---|
| PubChem CID | 67492758 |
| Molecular Formula | C21H26N4O2S |
| Molecular Weight | 398.53 g/mol |
| Exact Mass | 398.18 |
| IUPAC Name | 4-[7-[[amino(thiophen-2-yl)methylidene]amino]-2,3,4,5-tetrahydro-1-benzazepin-1-yl]piperidine-1-carboxylic acid |
| SMILES | N/C(=N\c1ccc2c(c1)CCCCN2C1CCN(C(=O)O)CC1)c1cccs1 |
| InChI | InChI=1S/C21H26N4O2S/c22-20(19-5-3-13-28-19)23-16-6-7-18-15(14-16)4-1-2-10-25(18)17-8-11-24(12-9-17)21(26)27/h3,5-7,13-14,17H,1-2,4,8-12H2,(H2,22,23)(H,26,27) |
| InChIKey | BRQNLWQVTJAYRJ-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 82.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.53 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|