C21H26N4OS — CID 53391875
N'-[1-[2-[(2S)-1-methylpyrrolidin-2-yl]ethyl]-2-oxo-3,4-dihydroquinolin-6-yl]thiophene-2-carboximidamide (PubChem CID 53391875) has the molecular formula C21H26N4OS and a molecular weight of 382.53 g/mol. Its IUPAC name is N'-[1-[2-[(2S)-1-methylpyrrolidin-2-yl]ethyl]-2-oxo-3,4-dihydroquinolin-6-yl]thiophene-2-carboximidamide.
| Compound Name | N'-[1-[2-[(2S)-1-methylpyrrolidin-2-yl]ethyl]-2-oxo-3,4-dihydroquinolin-6-yl]thiophene-2-carboximidamide |
|---|---|
| PubChem CID | 53391875 |
| Molecular Formula | C21H26N4OS |
| Molecular Weight | 382.53 g/mol |
| Exact Mass | 382.18 |
| IUPAC Name | N'-[1-[2-[(2S)-1-methylpyrrolidin-2-yl]ethyl]-2-oxo-3,4-dihydroquinolin-6-yl]thiophene-2-carboximidamide |
| SMILES | CN1CCC[C@H]1CCN1C(=O)CCc2cc(/N=C(\N)c3cccs3)ccc21 |
| InChI | InChI=1S/C21H26N4OS/c1-24-11-2-4-17(24)10-12-25-18-8-7-16(14-15(18)6-9-20(25)26)23-21(22)19-5-3-13-27-19/h3,5,7-8,13-14,17H,2,4,6,9-12H2,1H3,(H2,22,23)/t17-/m0/s1 |
| InChIKey | HCUBLNYMRSOIMI-KRWDZBQOSA-N |
| XLogP | 3.55 |
| TPSA | 61.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.53 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|