C21H26N4S — CID 24759031
N'-[1-[2-(1-methylpiperidin-2-yl)ethyl]indol-5-yl]thiophene-2-carboximidamide (PubChem CID 24759031) has the molecular formula C21H26N4S and a molecular weight of 366.53 g/mol. Its IUPAC name is N'-[1-[2-(1-methylpiperidin-2-yl)ethyl]indol-5-yl]thiophene-2-carboximidamide.
| Compound Name | N'-[1-[2-(1-methylpiperidin-2-yl)ethyl]indol-5-yl]thiophene-2-carboximidamide |
|---|---|
| PubChem CID | 24759031 |
| Molecular Formula | C21H26N4S |
| Molecular Weight | 366.53 g/mol |
| Exact Mass | 366.19 |
| IUPAC Name | N'-[1-[2-(1-methylpiperidin-2-yl)ethyl]indol-5-yl]thiophene-2-carboximidamide |
| SMILES | CN1CCCCC1CCn1ccc2cc(/N=C(\N)c3cccs3)ccc21 |
| InChI | InChI=1S/C21H26N4S/c1-24-11-3-2-5-18(24)10-13-25-12-9-16-15-17(7-8-19(16)25)23-21(22)20-6-4-14-26-20/h4,6-9,12,14-15,18H,2-3,5,10-11,13H2,1H3,(H2,22,23) |
| InChIKey | OTUXXVUYACDOIA-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 46.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.53 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|