C22H32Cl2N4S — CID 90665100
N'-[1-[2-(1-methylpyrrolidin-2-yl)ethyl]-2,3,4,5-tetrahydro-1-benzazepin-7-yl]thiophene-2-carboximidamide;dihydrochloride (PubChem CID 90665100) has the molecular formula C22H32Cl2N4S and a molecular weight of 455.50 g/mol. Its IUPAC name is N'-[1-[2-(1-methylpyrrolidin-2-yl)ethyl]-2,3,4,5-tetrahydro-1-benzazepin-7-yl]thiophene-2-carboximidamide;dihydrochloride.
| Compound Name | N'-[1-[2-(1-methylpyrrolidin-2-yl)ethyl]-2,3,4,5-tetrahydro-1-benzazepin-7-yl]thiophene-2-carboximidamide;dihydrochloride |
|---|---|
| PubChem CID | 90665100 |
| Molecular Formula | C22H32Cl2N4S |
| Molecular Weight | 455.50 g/mol |
| Exact Mass | 454.17 |
| IUPAC Name | N'-[1-[2-(1-methylpyrrolidin-2-yl)ethyl]-2,3,4,5-tetrahydro-1-benzazepin-7-yl]thiophene-2-carboximidamide;dihydrochloride |
| SMILES | CN1CCCC1CCN1CCCCc2cc(/N=C(\N)c3cccs3)ccc21.Cl.Cl |
| InChI | InChI=1S/C22H30N4S.2ClH/c1-25-12-4-7-19(25)11-14-26-13-3-2-6-17-16-18(9-10-20(17)26)24-22(23)21-8-5-15-27-21;;/h5,8-10,15-16,19H,2-4,6-7,11-14H2,1H3,(H2,23,24);2*1H |
| InChIKey | GLTYEGWWGPSILR-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 44.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.50 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|