C22H28N4S — CID 59807124
N'-[2-methylidene-1-(2-pyrrolidin-1-ylethyl)-4,5-dihydro-3H-1-benzazepin-7-yl]thiophene-2-carboximidamide (PubChem CID 59807124) has the molecular formula C22H28N4S and a molecular weight of 380.56 g/mol. Its IUPAC name is N'-[2-methylidene-1-(2-pyrrolidin-1-ylethyl)-4,5-dihydro-3H-1-benzazepin-7-yl]thiophene-2-carboximidamide.
| Compound Name | N'-[2-methylidene-1-(2-pyrrolidin-1-ylethyl)-4,5-dihydro-3H-1-benzazepin-7-yl]thiophene-2-carboximidamide |
|---|---|
| PubChem CID | 59807124 |
| Molecular Formula | C22H28N4S |
| Molecular Weight | 380.56 g/mol |
| Exact Mass | 380.20 |
| IUPAC Name | N'-[2-methylidene-1-(2-pyrrolidin-1-ylethyl)-4,5-dihydro-3H-1-benzazepin-7-yl]thiophene-2-carboximidamide |
| SMILES | C=C1CCCc2cc(/N=C(\N)c3cccs3)ccc2N1CCN1CCCC1 |
| InChI | InChI=1S/C22H28N4S/c1-17-6-4-7-18-16-19(24-22(23)21-8-5-15-27-21)9-10-20(18)26(17)14-13-25-11-2-3-12-25/h5,8-10,15-16H,1-4,6-7,11-14H2,(H2,23,24) |
| InChIKey | LWFWKTHLEMRNIC-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 44.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.56 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|