C21H28N4OS — CID 25014790
N'-[1-(3-morpholin-4-ylpropyl)-3,4-dihydro-2H-quinolin-6-yl]thiophene-2-carboximidamide (PubChem CID 25014790) has the molecular formula C21H28N4OS and a molecular weight of 384.55 g/mol. Its IUPAC name is N'-[1-(3-morpholin-4-ylpropyl)-3,4-dihydro-2H-quinolin-6-yl]thiophene-2-carboximidamide.
| Compound Name | N'-[1-(3-morpholin-4-ylpropyl)-3,4-dihydro-2H-quinolin-6-yl]thiophene-2-carboximidamide |
|---|---|
| PubChem CID | 25014790 |
| Molecular Formula | C21H28N4OS |
| Molecular Weight | 384.55 g/mol |
| Exact Mass | 384.20 |
| IUPAC Name | N'-[1-(3-morpholin-4-ylpropyl)-3,4-dihydro-2H-quinolin-6-yl]thiophene-2-carboximidamide |
| SMILES | N/C(=N\c1ccc2c(c1)CCCN2CCCN1CCOCC1)c1cccs1 |
| InChI | InChI=1S/C21H28N4OS/c22-21(20-5-2-15-27-20)23-18-6-7-19-17(16-18)4-1-9-25(19)10-3-8-24-11-13-26-14-12-24/h2,5-7,15-16H,1,3-4,8-14H2,(H2,22,23) |
| InChIKey | NQCSVPBYGIUXDI-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 54.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.55 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|