C19H25N5OS2 — CID 142858740
N'-[2-[2-(1,4-oxazepan-4-yl)ethylamino]-2,3-dihydro-1,3-benzothiazol-6-yl]thiophene-2-carboximidamide (PubChem CID 142858740) has the molecular formula C19H25N5OS2 and a molecular weight of 403.58 g/mol. Its IUPAC name is N'-[2-[2-(1,4-oxazepan-4-yl)ethylamino]-2,3-dihydro-1,3-benzothiazol-6-yl]thiophene-2-carboximidamide.
| Compound Name | N'-[2-[2-(1,4-oxazepan-4-yl)ethylamino]-2,3-dihydro-1,3-benzothiazol-6-yl]thiophene-2-carboximidamide |
|---|---|
| PubChem CID | 142858740 |
| Molecular Formula | C19H25N5OS2 |
| Molecular Weight | 403.58 g/mol |
| Exact Mass | 403.15 |
| IUPAC Name | N'-[2-[2-(1,4-oxazepan-4-yl)ethylamino]-2,3-dihydro-1,3-benzothiazol-6-yl]thiophene-2-carboximidamide |
| SMILES | N/C(=N\c1ccc2c(c1)SC(NCCN1CCCOCC1)N2)c1cccs1 |
| InChI | InChI=1S/C19H25N5OS2/c20-18(16-3-1-12-26-16)22-14-4-5-15-17(13-14)27-19(23-15)21-6-8-24-7-2-10-25-11-9-24/h1,3-5,12-13,19,21,23H,2,6-11H2,(H2,20,22) |
| InChIKey | VYUCCPDYURICDV-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 74.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.58 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|