C17H25N3O3S — CID 78844704
N-(2-morpholin-4-ylethyl)-1-(thiophene-2-carbonyl)piperidine-2-carboxamide (PubChem CID 78844704) has the molecular formula C17H25N3O3S and a molecular weight of 351.47 g/mol. Its IUPAC name is N-(2-morpholin-4-ylethyl)-1-(thiophene-2-carbonyl)piperidine-2-carboxamide.
| Compound Name | N-(2-morpholin-4-ylethyl)-1-(thiophene-2-carbonyl)piperidine-2-carboxamide |
|---|---|
| PubChem CID | 78844704 |
| Molecular Formula | C17H25N3O3S |
| Molecular Weight | 351.47 g/mol |
| Exact Mass | 351.16 |
| IUPAC Name | N-(2-morpholin-4-ylethyl)-1-(thiophene-2-carbonyl)piperidine-2-carboxamide |
| SMILES | O=C(NCCN1CCOCC1)C1CCCCN1C(=O)c1cccs1 |
| InChI | InChI=1S/C17H25N3O3S/c21-16(18-6-8-19-9-11-23-12-10-19)14-4-1-2-7-20(14)17(22)15-5-3-13-24-15/h3,5,13-14H,1-2,4,6-12H2,(H,18,21) |
| InChIKey | BYKRALAKKMANPG-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.47 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |