C16H22N2O2S2 — CID 124573724
(2R)-N-[[(2R)-thiolan-2-yl]methyl]-1-(thiophene-2-carbonyl)piperidine-2-carboxamide (PubChem CID 124573724) has the molecular formula C16H22N2O2S2 and a molecular weight of 338.50 g/mol. Its IUPAC name is (2R)-N-[[(2R)-thiolan-2-yl]methyl]-1-(thiophene-2-carbonyl)piperidine-2-carboxamide.
| Compound Name | (2R)-N-[[(2R)-thiolan-2-yl]methyl]-1-(thiophene-2-carbonyl)piperidine-2-carboxamide |
|---|---|
| PubChem CID | 124573724 |
| Molecular Formula | C16H22N2O2S2 |
| Molecular Weight | 338.50 g/mol |
| Exact Mass | 338.11 |
| IUPAC Name | (2R)-N-[[(2R)-thiolan-2-yl]methyl]-1-(thiophene-2-carbonyl)piperidine-2-carboxamide |
| SMILES | O=C(NC[C@H]1CCCS1)[C@H]1CCCCN1C(=O)c1cccs1 |
| InChI | InChI=1S/C16H22N2O2S2/c19-15(17-11-12-5-3-9-21-12)13-6-1-2-8-18(13)16(20)14-7-4-10-22-14/h4,7,10,12-13H,1-3,5-6,8-9,11H2,(H,17,19)/t12-,13-/m1/s1 |
| InChIKey | WWTHCSFEHOVDON-CHWSQXEVSA-N |
| XLogP | 2.75 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.50 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |