C21H28N2O2S — CID 8927607
(2R)-N-(1-adamantylmethyl)-1-(thiophene-2-carbonyl)pyrrolidine-2-carboxamide (PubChem CID 8927607) has the molecular formula C21H28N2O2S and a molecular weight of 372.53 g/mol. Its IUPAC name is (2R)-N-(1-adamantylmethyl)-1-(thiophene-2-carbonyl)pyrrolidine-2-carboxamide.
| Compound Name | (2R)-N-(1-adamantylmethyl)-1-(thiophene-2-carbonyl)pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 8927607 |
| Molecular Formula | C21H28N2O2S |
| Molecular Weight | 372.53 g/mol |
| Exact Mass | 372.19 |
| IUPAC Name | (2R)-N-(1-adamantylmethyl)-1-(thiophene-2-carbonyl)pyrrolidine-2-carboxamide |
| SMILES | O=C(NCC12CC3CC(CC(C3)C1)C2)[C@H]1CCCN1C(=O)c1cccs1 |
| InChI | InChI=1S/C21H28N2O2S/c24-19(17-3-1-5-23(17)20(25)18-4-2-6-26-18)22-13-21-10-14-7-15(11-21)9-16(8-14)12-21/h2,4,6,14-17H,1,3,5,7-13H2,(H,22,24)/t14?,15?,16?,17-,21?/m1/s1 |
| InChIKey | GOPMOORHSYUCLD-JRQWYPPZSA-N |
| XLogP | 3.69 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.53 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |