C22H35N3O3S — CID 78863262
N-(3-ethyl-2-morpholin-4-ylpentyl)-1-(thiophene-2-carbonyl)piperidine-2-carboxamide (PubChem CID 78863262) has the molecular formula C22H35N3O3S and a molecular weight of 421.61 g/mol. Its IUPAC name is N-(3-ethyl-2-morpholin-4-ylpentyl)-1-(thiophene-2-carbonyl)piperidine-2-carboxamide.
| Compound Name | N-(3-ethyl-2-morpholin-4-ylpentyl)-1-(thiophene-2-carbonyl)piperidine-2-carboxamide |
|---|---|
| PubChem CID | 78863262 |
| Molecular Formula | C22H35N3O3S |
| Molecular Weight | 421.61 g/mol |
| Exact Mass | 421.24 |
| IUPAC Name | N-(3-ethyl-2-morpholin-4-ylpentyl)-1-(thiophene-2-carbonyl)piperidine-2-carboxamide |
| SMILES | CCC(CC)C(CNC(=O)C1CCCCN1C(=O)c1cccs1)N1CCOCC1 |
| InChI | InChI=1S/C22H35N3O3S/c1-3-17(4-2)19(24-11-13-28-14-12-24)16-23-21(26)18-8-5-6-10-25(18)22(27)20-9-7-15-29-20/h7,9,15,17-19H,3-6,8,10-14,16H2,1-2H3,(H,23,26) |
| InChIKey | ZJQTZCBNTGBGOS-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.61 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |