C21H27N3O2S — CID 78844749
N-[2-(dimethylamino)-2-phenylethyl]-1-(thiophene-2-carbonyl)piperidine-2-carboxamide (PubChem CID 78844749) has the molecular formula C21H27N3O2S and a molecular weight of 385.53 g/mol. Its IUPAC name is N-[2-(dimethylamino)-2-phenylethyl]-1-(thiophene-2-carbonyl)piperidine-2-carboxamide.
| Compound Name | N-[2-(dimethylamino)-2-phenylethyl]-1-(thiophene-2-carbonyl)piperidine-2-carboxamide |
|---|---|
| PubChem CID | 78844749 |
| Molecular Formula | C21H27N3O2S |
| Molecular Weight | 385.53 g/mol |
| Exact Mass | 385.18 |
| IUPAC Name | N-[2-(dimethylamino)-2-phenylethyl]-1-(thiophene-2-carbonyl)piperidine-2-carboxamide |
| SMILES | CN(C)C(CNC(=O)C1CCCCN1C(=O)c1cccs1)c1ccccc1 |
| InChI | InChI=1S/C21H27N3O2S/c1-23(2)18(16-9-4-3-5-10-16)15-22-20(25)17-11-6-7-13-24(17)21(26)19-12-8-14-27-19/h3-5,8-10,12,14,17-18H,6-7,11,13,15H2,1-2H3,(H,22,25) |
| InChIKey | CCEQWOKGFIIYSD-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.53 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |