C20H32N4O2S — CID 78876347
N-[2-(4-ethylpiperazin-1-yl)propyl]-1-(thiophene-2-carbonyl)piperidine-2-carboxamide (PubChem CID 78876347) has the molecular formula C20H32N4O2S and a molecular weight of 392.57 g/mol. Its IUPAC name is N-[2-(4-ethylpiperazin-1-yl)propyl]-1-(thiophene-2-carbonyl)piperidine-2-carboxamide.
| Compound Name | N-[2-(4-ethylpiperazin-1-yl)propyl]-1-(thiophene-2-carbonyl)piperidine-2-carboxamide |
|---|---|
| PubChem CID | 78876347 |
| Molecular Formula | C20H32N4O2S |
| Molecular Weight | 392.57 g/mol |
| Exact Mass | 392.22 |
| IUPAC Name | N-[2-(4-ethylpiperazin-1-yl)propyl]-1-(thiophene-2-carbonyl)piperidine-2-carboxamide |
| SMILES | CCN1CCN(C(C)CNC(=O)C2CCCCN2C(=O)c2cccs2)CC1 |
| InChI | InChI=1S/C20H32N4O2S/c1-3-22-10-12-23(13-11-22)16(2)15-21-19(25)17-7-4-5-9-24(17)20(26)18-8-6-14-27-18/h6,8,14,16-17H,3-5,7,9-13,15H2,1-2H3,(H,21,25) |
| InChIKey | GWWZFXMCGJVBPO-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 55.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.57 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |