C20H25N3OS — CID 143559882
ethane;N'-[1-(oxan-4-yl)indol-5-yl]thiophene-2-carboximidamide (PubChem CID 143559882) has the molecular formula C20H25N3OS and a molecular weight of 355.51 g/mol. Its IUPAC name is ethane;N'-[1-(oxan-4-yl)indol-5-yl]thiophene-2-carboximidamide.
| Compound Name | ethane;N'-[1-(oxan-4-yl)indol-5-yl]thiophene-2-carboximidamide |
|---|---|
| PubChem CID | 143559882 |
| Molecular Formula | C20H25N3OS |
| Molecular Weight | 355.51 g/mol |
| Exact Mass | 355.17 |
| IUPAC Name | ethane;N'-[1-(oxan-4-yl)indol-5-yl]thiophene-2-carboximidamide |
| SMILES | CC.N/C(=N\c1ccc2c(ccn2C2CCOCC2)c1)c1cccs1 |
| InChI | InChI=1S/C18H19N3OS.C2H6/c19-18(17-2-1-11-23-17)20-14-3-4-16-13(12-14)5-8-21(16)15-6-9-22-10-7-15;1-2/h1-5,8,11-12,15H,6-7,9-10H2,(H2,19,20);1-2H3 |
| InChIKey | SUXBNQBVEFLDSL-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 52.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.51 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|