C60H72N12O3 — CID 159739532
N'-[1-(1-methylazepan-4-yl)indol-5-yl]furan-2-carboximidamide (PubChem CID 159739532) has the molecular formula C60H72N12O3 and a molecular weight of 1009.32 g/mol. Its IUPAC name is N'-[1-(1-methylazepan-4-yl)indol-5-yl]furan-2-carboximidamide.
| Compound Name | N'-[1-(1-methylazepan-4-yl)indol-5-yl]furan-2-carboximidamide |
|---|---|
| PubChem CID | 159739532 |
| Molecular Formula | C60H72N12O3 |
| Molecular Weight | 1009.32 g/mol |
| Exact Mass | 1008.59 |
| IUPAC Name | N'-[1-(1-methylazepan-4-yl)indol-5-yl]furan-2-carboximidamide |
| SMILES | CN1CCCC(n2ccc3cc(/N=C(\N)c4ccco4)ccc32)CC1.CN1CCCC(n2ccc3cc(/N=C(\N)c4ccco4)ccc32)CC1.CN1CCCC(n2ccc3cc(/N=C(\N)c4ccco4)ccc32)CC1 |
| InChI | InChI=1S/3C20H24N4O/c3*1-23-10-2-4-17(9-11-23)24-12-8-15-14-16(6-7-18(15)24)22-20(21)19-5-3-13-25-19/h3*3,5-8,12-14,17H,2,4,9-11H2,1H3,(H2,21,22) |
| InChIKey | NCGQVJHLJKELCY-UHFFFAOYSA-N |
| XLogP | 11.78 |
| TPSA | 179.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 75 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1009.32 |
| LogP ≤ 5 | 11.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|