C20H22N4O — CID 15951405
N'-[3-(1-azabicyclo[2.2.2]octan-3-yl)-1H-indol-5-yl]furan-2-carboximidamide (PubChem CID 15951405) has the molecular formula C20H22N4O and a molecular weight of 334.42 g/mol. Its IUPAC name is N'-[3-(1-azabicyclo[2.2.2]octan-3-yl)-1H-indol-5-yl]furan-2-carboximidamide.
| Compound Name | N'-[3-(1-azabicyclo[2.2.2]octan-3-yl)-1H-indol-5-yl]furan-2-carboximidamide |
|---|---|
| PubChem CID | 15951405 |
| Molecular Formula | C20H22N4O |
| Molecular Weight | 334.42 g/mol |
| Exact Mass | 334.18 |
| IUPAC Name | N'-[3-(1-azabicyclo[2.2.2]octan-3-yl)-1H-indol-5-yl]furan-2-carboximidamide |
| SMILES | N/C(=N\c1ccc2[nH]cc(C3CN4CCC3CC4)c2c1)c1ccco1 |
| InChI | InChI=1S/C20H22N4O/c21-20(19-2-1-9-25-19)23-14-3-4-18-15(10-14)16(11-22-18)17-12-24-7-5-13(17)6-8-24/h1-4,9-11,13,17,22H,5-8,12H2,(H2,21,23) |
| InChIKey | ZPALVTAUXXCYMC-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 70.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.42 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|