C33H38N6O — CID 142782455
N,N'-bis[3-(1-methylpiperidin-4-yl)-1H-indol-5-yl]furan-2-carboximidamide (PubChem CID 142782455) has the molecular formula C33H38N6O and a molecular weight of 534.71 g/mol. Its IUPAC name is N,N'-bis[3-(1-methylpiperidin-4-yl)-1H-indol-5-yl]furan-2-carboximidamide.
| Compound Name | N,N'-bis[3-(1-methylpiperidin-4-yl)-1H-indol-5-yl]furan-2-carboximidamide |
|---|---|
| PubChem CID | 142782455 |
| Molecular Formula | C33H38N6O |
| Molecular Weight | 534.71 g/mol |
| Exact Mass | 534.31 |
| IUPAC Name | N,N'-bis[3-(1-methylpiperidin-4-yl)-1H-indol-5-yl]furan-2-carboximidamide |
| SMILES | CN1CCC(c2c[nH]c3ccc(/N=C(/Nc4ccc5[nH]cc(C6CCN(C)CC6)c5c4)c4ccco4)cc23)CC1 |
| InChI | InChI=1S/C33H38N6O/c1-38-13-9-22(10-14-38)28-20-34-30-7-5-24(18-26(28)30)36-33(32-4-3-17-40-32)37-25-6-8-31-27(19-25)29(21-35-31)23-11-15-39(2)16-12-23/h3-8,17-23,34-35H,9-16H2,1-2H3,(H,36,37) |
| InChIKey | QKRRUCGKNAEPAE-UHFFFAOYSA-N |
| XLogP | 7.05 |
| TPSA | 75.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.71 |
| LogP ≤ 5 | 7.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|