C21H21Cl2N3O — CID 22611201
3,5-dichloro-N-[3-(1-methylpiperidin-4-yl)-1H-indol-5-yl]benzamide (PubChem CID 22611201) has the molecular formula C21H21Cl2N3O and a molecular weight of 402.33 g/mol. Its IUPAC name is 3,5-dichloro-N-[3-(1-methylpiperidin-4-yl)-1H-indol-5-yl]benzamide.
| Compound Name | 3,5-dichloro-N-[3-(1-methylpiperidin-4-yl)-1H-indol-5-yl]benzamide |
|---|---|
| PubChem CID | 22611201 |
| Molecular Formula | C21H21Cl2N3O |
| Molecular Weight | 402.33 g/mol |
| Exact Mass | 401.11 |
| IUPAC Name | 3,5-dichloro-N-[3-(1-methylpiperidin-4-yl)-1H-indol-5-yl]benzamide |
| SMILES | CN1CCC(c2c[nH]c3ccc(NC(=O)c4cc(Cl)cc(Cl)c4)cc23)CC1 |
| InChI | InChI=1S/C21H21Cl2N3O/c1-26-6-4-13(5-7-26)19-12-24-20-3-2-17(11-18(19)20)25-21(27)14-8-15(22)10-16(23)9-14/h2-3,8-13,24H,4-7H2,1H3,(H,25,27) |
| InChIKey | AUEGQOJAUAZTFS-UHFFFAOYSA-N |
| XLogP | 5.54 |
| TPSA | 48.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.33 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |