C22H25N3S — CID 140998243
4-methyl-N-[3-(1-methylpiperidin-4-yl)-1H-indol-5-yl]benzenecarbothioamide (PubChem CID 140998243) has the molecular formula C22H25N3S and a molecular weight of 363.53 g/mol. Its IUPAC name is 4-methyl-N-[3-(1-methylpiperidin-4-yl)-1H-indol-5-yl]benzenecarbothioamide.
| Compound Name | 4-methyl-N-[3-(1-methylpiperidin-4-yl)-1H-indol-5-yl]benzenecarbothioamide |
|---|---|
| PubChem CID | 140998243 |
| Molecular Formula | C22H25N3S |
| Molecular Weight | 363.53 g/mol |
| Exact Mass | 363.18 |
| IUPAC Name | 4-methyl-N-[3-(1-methylpiperidin-4-yl)-1H-indol-5-yl]benzenecarbothioamide |
| SMILES | Cc1ccc(C(=S)Nc2ccc3[nH]cc(C4CCN(C)CC4)c3c2)cc1 |
| InChI | InChI=1S/C22H25N3S/c1-15-3-5-17(6-4-15)22(26)24-18-7-8-21-19(13-18)20(14-23-21)16-9-11-25(2)12-10-16/h3-8,13-14,16,23H,9-12H2,1-2H3,(H,24,26) |
| InChIKey | DCLFBFGWFFCPPG-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 31.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.53 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|