C21H27N3O5 — CID 70104762
but-2-enedioic acid;N-[3-(1-methylpiperidin-4-yl)-1H-indol-5-yl]propanamide (PubChem CID 70104762) has the molecular formula C21H27N3O5 and a molecular weight of 401.46 g/mol. Its IUPAC name is but-2-enedioic acid;N-[3-(1-methylpiperidin-4-yl)-1H-indol-5-yl]propanamide.
| Compound Name | but-2-enedioic acid;N-[3-(1-methylpiperidin-4-yl)-1H-indol-5-yl]propanamide |
|---|---|
| PubChem CID | 70104762 |
| Molecular Formula | C21H27N3O5 |
| Molecular Weight | 401.46 g/mol |
| Exact Mass | 401.20 |
| IUPAC Name | but-2-enedioic acid;N-[3-(1-methylpiperidin-4-yl)-1H-indol-5-yl]propanamide |
| SMILES | CCC(=O)Nc1ccc2[nH]cc(C3CCN(C)CC3)c2c1.O=C(O)C=CC(=O)O |
| InChI | InChI=1S/C17H23N3O.C4H4O4/c1-3-17(21)19-13-4-5-16-14(10-13)15(11-18-16)12-6-8-20(2)9-7-12;5-3(6)1-2-4(7)8/h4-5,10-12,18H,3,6-9H2,1-2H3,(H,19,21);1-2H,(H,5,6)(H,7,8) |
| InChIKey | SLYBSAJACZNQHO-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 122.73 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.46 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|