C28H36N4O2 — CID 54233001
1-[3-(1-pentylpiperidin-4-yl)-1H-indol-5-yl]-3-(3-propanoylphenyl)urea (PubChem CID 54233001) has the molecular formula C28H36N4O2 and a molecular weight of 460.62 g/mol. Its IUPAC name is 1-[3-(1-pentylpiperidin-4-yl)-1H-indol-5-yl]-3-(3-propanoylphenyl)urea.
| Compound Name | 1-[3-(1-pentylpiperidin-4-yl)-1H-indol-5-yl]-3-(3-propanoylphenyl)urea |
|---|---|
| PubChem CID | 54233001 |
| Molecular Formula | C28H36N4O2 |
| Molecular Weight | 460.62 g/mol |
| Exact Mass | 460.28 |
| IUPAC Name | 1-[3-(1-pentylpiperidin-4-yl)-1H-indol-5-yl]-3-(3-propanoylphenyl)urea |
| SMILES | CCCCCN1CCC(c2c[nH]c3ccc(NC(=O)Nc4cccc(C(=O)CC)c4)cc23)CC1 |
| InChI | InChI=1S/C28H36N4O2/c1-3-5-6-14-32-15-12-20(13-16-32)25-19-29-26-11-10-23(18-24(25)26)31-28(34)30-22-9-7-8-21(17-22)27(33)4-2/h7-11,17-20,29H,3-6,12-16H2,1-2H3,(H2,30,31,34) |
| InChIKey | QKOSTVYFQVZAJT-UHFFFAOYSA-N |
| XLogP | 6.77 |
| TPSA | 77.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.62 |
| LogP ≤ 5 | 6.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|