C45H66N8O2 — CID 160688315
1-[3-(1-butan-2-ylpiperidin-4-yl)-1H-indol-5-yl]-3-pent-3-enylurea;1-but-2-enyl-3-[3-(1-butylpiperidin-4-yl)-1H-indol-5-yl]urea (PubChem CID 160688315) has the molecular formula C45H66N8O2 and a molecular weight of 751.08 g/mol. Its IUPAC name is 1-[3-(1-butan-2-ylpiperidin-4-yl)-1H-indol-5-yl]-3-pent-3-enylurea;1-but-2-enyl-3-[3-(1-butylpiperidin-4-yl)-1H-indol-5-yl]urea.
| Compound Name | 1-[3-(1-butan-2-ylpiperidin-4-yl)-1H-indol-5-yl]-3-pent-3-enylurea;1-but-2-enyl-3-[3-(1-butylpiperidin-4-yl)-1H-indol-5-yl]urea |
|---|---|
| PubChem CID | 160688315 |
| Molecular Formula | C45H66N8O2 |
| Molecular Weight | 751.08 g/mol |
| Exact Mass | 750.53 |
| IUPAC Name | 1-[3-(1-butan-2-ylpiperidin-4-yl)-1H-indol-5-yl]-3-pent-3-enylurea;1-but-2-enyl-3-[3-(1-butylpiperidin-4-yl)-1H-indol-5-yl]urea |
| SMILES | CC=CCCNC(=O)Nc1ccc2[nH]cc(C3CCN(C(C)CC)CC3)c2c1.CC=CCNC(=O)Nc1ccc2[nH]cc(C3CCN(CCCC)CC3)c2c1 |
| InChI | InChI=1S/C23H34N4O.C22H32N4O/c1-4-6-7-12-24-23(28)26-19-8-9-22-20(15-19)21(16-25-22)18-10-13-27(14-11-18)17(3)5-2;1-3-5-11-23-22(27)25-18-7-8-21-19(15-18)20(16-24-21)17-9-13-26(14-10-17)12-6-4-2/h4,6,8-9,15-18,25H,5,7,10-14H2,1-3H3,(H2,24,26,28);3,5,7-8,15-17,24H,4,6,9-14H2,1-2H3,(H2,23,25,27) |
| InChIKey | RPBKVFJBXLEBTK-UHFFFAOYSA-N |
| XLogP | 10.08 |
| TPSA | 120.32 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 55 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 751.08 |
| LogP ≤ 5 | 10.08 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|