C23H29N3O2 — CID 54567819
N-[3-(1-pentan-3-ylpiperidin-4-yl)-1H-indol-5-yl]furan-3-carboxamide (PubChem CID 54567819) has the molecular formula C23H29N3O2 and a molecular weight of 379.50 g/mol. Its IUPAC name is N-[3-(1-pentan-3-ylpiperidin-4-yl)-1H-indol-5-yl]furan-3-carboxamide.
| Compound Name | N-[3-(1-pentan-3-ylpiperidin-4-yl)-1H-indol-5-yl]furan-3-carboxamide |
|---|---|
| PubChem CID | 54567819 |
| Molecular Formula | C23H29N3O2 |
| Molecular Weight | 379.50 g/mol |
| Exact Mass | 379.23 |
| IUPAC Name | N-[3-(1-pentan-3-ylpiperidin-4-yl)-1H-indol-5-yl]furan-3-carboxamide |
| SMILES | CCC(CC)N1CCC(c2c[nH]c3ccc(NC(=O)c4ccoc4)cc23)CC1 |
| InChI | InChI=1S/C23H29N3O2/c1-3-19(4-2)26-10-7-16(8-11-26)21-14-24-22-6-5-18(13-20(21)22)25-23(27)17-9-12-28-15-17/h5-6,9,12-16,19,24H,3-4,7-8,10-11H2,1-2H3,(H,25,27) |
| InChIKey | ZVCBXJABNOGUIA-UHFFFAOYSA-N |
| XLogP | 5.38 |
| TPSA | 61.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.50 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |