C25H30FN3O — CID 54306354
4-fluoro-N-[3-(1-pentan-3-ylpiperidin-4-yl)-1H-indol-5-yl]benzamide (PubChem CID 54306354) has the molecular formula C25H30FN3O and a molecular weight of 407.53 g/mol. Its IUPAC name is 4-fluoro-N-[3-(1-pentan-3-ylpiperidin-4-yl)-1H-indol-5-yl]benzamide.
| Compound Name | 4-fluoro-N-[3-(1-pentan-3-ylpiperidin-4-yl)-1H-indol-5-yl]benzamide |
|---|---|
| PubChem CID | 54306354 |
| Molecular Formula | C25H30FN3O |
| Molecular Weight | 407.53 g/mol |
| Exact Mass | 407.24 |
| IUPAC Name | 4-fluoro-N-[3-(1-pentan-3-ylpiperidin-4-yl)-1H-indol-5-yl]benzamide |
| SMILES | CCC(CC)N1CCC(c2c[nH]c3ccc(NC(=O)c4ccc(F)cc4)cc23)CC1 |
| InChI | InChI=1S/C25H30FN3O/c1-3-21(4-2)29-13-11-17(12-14-29)23-16-27-24-10-9-20(15-22(23)24)28-25(30)18-5-7-19(26)8-6-18/h5-10,15-17,21,27H,3-4,11-14H2,1-2H3,(H,28,30) |
| InChIKey | SHULESGFLGJPGA-UHFFFAOYSA-N |
| XLogP | 5.93 |
| TPSA | 48.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.53 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |