C26H29N3O6 — CID 22611180
(E)-but-2-enedioic acid;3-methoxy-N-[3-(1-methylpiperidin-4-yl)-1H-indol-5-yl]benzamide (PubChem CID 22611180) has the molecular formula C26H29N3O6 and a molecular weight of 479.53 g/mol. Its IUPAC name is (E)-but-2-enedioic acid;3-methoxy-N-[3-(1-methylpiperidin-4-yl)-1H-indol-5-yl]benzamide.
| Compound Name | (E)-but-2-enedioic acid;3-methoxy-N-[3-(1-methylpiperidin-4-yl)-1H-indol-5-yl]benzamide |
|---|---|
| PubChem CID | 22611180 |
| Molecular Formula | C26H29N3O6 |
| Molecular Weight | 479.53 g/mol |
| Exact Mass | 479.21 |
| IUPAC Name | (E)-but-2-enedioic acid;3-methoxy-N-[3-(1-methylpiperidin-4-yl)-1H-indol-5-yl]benzamide |
| SMILES | COc1cccc(C(=O)Nc2ccc3[nH]cc(C4CCN(C)CC4)c3c2)c1.O=C(O)/C=C/C(=O)O |
| InChI | InChI=1S/C22H25N3O2.C4H4O4/c1-25-10-8-15(9-11-25)20-14-23-21-7-6-17(13-19(20)21)24-22(26)16-4-3-5-18(12-16)27-2;5-3(6)1-2-4(7)8/h3-7,12-15,23H,8-11H2,1-2H3,(H,24,26);1-2H,(H,5,6)(H,7,8)/b;2-1+ |
| InChIKey | IWXIPBCCWRTLAH-WLHGVMLRSA-N |
| XLogP | 3.95 |
| TPSA | 131.96 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.53 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|