C34H41N3O4 — CID 67667885
1-[3-(1-pentylpiperidin-4-yl)-1-benzofuran-5-yl]-3-phenylurea;2-phenylpropanoic acid (PubChem CID 67667885) has the molecular formula C34H41N3O4 and a molecular weight of 555.72 g/mol. Its IUPAC name is 1-[3-(1-pentylpiperidin-4-yl)-1-benzofuran-5-yl]-3-phenylurea;2-phenylpropanoic acid.
| Compound Name | 1-[3-(1-pentylpiperidin-4-yl)-1-benzofuran-5-yl]-3-phenylurea;2-phenylpropanoic acid |
|---|---|
| PubChem CID | 67667885 |
| Molecular Formula | C34H41N3O4 |
| Molecular Weight | 555.72 g/mol |
| Exact Mass | 555.31 |
| IUPAC Name | 1-[3-(1-pentylpiperidin-4-yl)-1-benzofuran-5-yl]-3-phenylurea;2-phenylpropanoic acid |
| SMILES | CC(C(=O)O)c1ccccc1.CCCCCN1CCC(c2coc3ccc(NC(=O)Nc4ccccc4)cc23)CC1 |
| InChI | InChI=1S/C25H31N3O2.C9H10O2/c1-2-3-7-14-28-15-12-19(13-16-28)23-18-30-24-11-10-21(17-22(23)24)27-25(29)26-20-8-5-4-6-9-20;1-7(9(10)11)8-5-3-2-4-6-8/h4-6,8-11,17-19H,2-3,7,12-16H2,1H3,(H2,26,27,29);2-7H,1H3,(H,10,11) |
| InChIKey | RFOOZXIUWHJNCB-UHFFFAOYSA-N |
| XLogP | 8.32 |
| TPSA | 94.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.72 |
| LogP ≤ 5 | 8.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|