C28H35N3O4 — CID 19064548
butyl 2-[[3-(1-propylpiperidin-4-yl)-1-benzofuran-5-yl]carbamoylamino]benzoate (PubChem CID 19064548) has the molecular formula C28H35N3O4 and a molecular weight of 477.61 g/mol. Its IUPAC name is butyl 2-[[3-(1-propylpiperidin-4-yl)-1-benzofuran-5-yl]carbamoylamino]benzoate.
| Compound Name | butyl 2-[[3-(1-propylpiperidin-4-yl)-1-benzofuran-5-yl]carbamoylamino]benzoate |
|---|---|
| PubChem CID | 19064548 |
| Molecular Formula | C28H35N3O4 |
| Molecular Weight | 477.61 g/mol |
| Exact Mass | 477.26 |
| IUPAC Name | butyl 2-[[3-(1-propylpiperidin-4-yl)-1-benzofuran-5-yl]carbamoylamino]benzoate |
| SMILES | CCCCOC(=O)c1ccccc1NC(=O)Nc1ccc2occ(C3CCN(CCC)CC3)c2c1 |
| InChI | InChI=1S/C28H35N3O4/c1-3-5-17-34-27(32)22-8-6-7-9-25(22)30-28(33)29-21-10-11-26-23(18-21)24(19-35-26)20-12-15-31(14-4-2)16-13-20/h6-11,18-20H,3-5,12-17H2,1-2H3,(H2,29,30,33) |
| InChIKey | GVDQKVSTCLHBRT-UHFFFAOYSA-N |
| XLogP | 6.62 |
| TPSA | 83.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.61 |
| LogP ≤ 5 | 6.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|