C22H32N2O2 — CID 19064672
2-methyl-N-[3-(1-pentylpiperidin-4-yl)-1-benzofuran-5-yl]propanamide (PubChem CID 19064672) has the molecular formula C22H32N2O2 and a molecular weight of 356.51 g/mol. Its IUPAC name is 2-methyl-N-[3-(1-pentylpiperidin-4-yl)-1-benzofuran-5-yl]propanamide.
| Compound Name | 2-methyl-N-[3-(1-pentylpiperidin-4-yl)-1-benzofuran-5-yl]propanamide |
|---|---|
| PubChem CID | 19064672 |
| Molecular Formula | C22H32N2O2 |
| Molecular Weight | 356.51 g/mol |
| Exact Mass | 356.25 |
| IUPAC Name | 2-methyl-N-[3-(1-pentylpiperidin-4-yl)-1-benzofuran-5-yl]propanamide |
| SMILES | CCCCCN1CCC(c2coc3ccc(NC(=O)C(C)C)cc23)CC1 |
| InChI | InChI=1S/C22H32N2O2/c1-4-5-6-11-24-12-9-17(10-13-24)20-15-26-21-8-7-18(14-19(20)21)23-22(25)16(2)3/h7-8,14-17H,4-6,9-13H2,1-3H3,(H,23,25) |
| InChIKey | GSYGCEVKSMDACH-UHFFFAOYSA-N |
| XLogP | 5.40 |
| TPSA | 45.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.51 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|