C26H36N4O — CID 89383026
N-[3-[1-[3-(1-anilinoethenylamino)propyl]piperidin-4-yl]phenyl]-2-methylpropanamide (PubChem CID 89383026) has the molecular formula C26H36N4O and a molecular weight of 420.60 g/mol. Its IUPAC name is N-[3-[1-[3-(1-anilinoethenylamino)propyl]piperidin-4-yl]phenyl]-2-methylpropanamide.
| Compound Name | N-[3-[1-[3-(1-anilinoethenylamino)propyl]piperidin-4-yl]phenyl]-2-methylpropanamide |
|---|---|
| PubChem CID | 89383026 |
| Molecular Formula | C26H36N4O |
| Molecular Weight | 420.60 g/mol |
| Exact Mass | 420.29 |
| IUPAC Name | N-[3-[1-[3-(1-anilinoethenylamino)propyl]piperidin-4-yl]phenyl]-2-methylpropanamide |
| SMILES | C=C(NCCCN1CCC(c2cccc(NC(=O)C(C)C)c2)CC1)Nc1ccccc1 |
| InChI | InChI=1S/C26H36N4O/c1-20(2)26(31)29-25-12-7-9-23(19-25)22-13-17-30(18-14-22)16-8-15-27-21(3)28-24-10-5-4-6-11-24/h4-7,9-12,19-20,22,27-28H,3,8,13-18H2,1-2H3,(H,29,31) |
| InChIKey | GSAVGDUXEBNLRP-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 56.40 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.60 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|