C26H33Cl2N3O2 — CID 22048745
3,5-dichloro-N-[4-[4-[3-(2-methylpropanoylamino)phenyl]piperidin-1-yl]butyl]benzamide (PubChem CID 22048745) has the molecular formula C26H33Cl2N3O2 and a molecular weight of 490.48 g/mol. Its IUPAC name is 3,5-dichloro-N-[4-[4-[3-(2-methylpropanoylamino)phenyl]piperidin-1-yl]butyl]benzamide.
| Compound Name | 3,5-dichloro-N-[4-[4-[3-(2-methylpropanoylamino)phenyl]piperidin-1-yl]butyl]benzamide |
|---|---|
| PubChem CID | 22048745 |
| Molecular Formula | C26H33Cl2N3O2 |
| Molecular Weight | 490.48 g/mol |
| Exact Mass | 489.19 |
| IUPAC Name | 3,5-dichloro-N-[4-[4-[3-(2-methylpropanoylamino)phenyl]piperidin-1-yl]butyl]benzamide |
| SMILES | CC(C)C(=O)Nc1cccc(C2CCN(CCCCNC(=O)c3cc(Cl)cc(Cl)c3)CC2)c1 |
| InChI | InChI=1S/C26H33Cl2N3O2/c1-18(2)25(32)30-24-7-5-6-20(16-24)19-8-12-31(13-9-19)11-4-3-10-29-26(33)21-14-22(27)17-23(28)15-21/h5-7,14-19H,3-4,8-13H2,1-2H3,(H,29,33)(H,30,32) |
| InChIKey | QJDOVAQLCYDBGA-UHFFFAOYSA-N |
| XLogP | 5.98 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.48 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|