C25H32N2O — CID 142203721
2-methyl-N-[3-[1-(3-phenylbut-3-enyl)piperidin-4-yl]phenyl]propanamide (PubChem CID 142203721) has the molecular formula C25H32N2O and a molecular weight of 376.54 g/mol. Its IUPAC name is 2-methyl-N-[3-[1-(3-phenylbut-3-enyl)piperidin-4-yl]phenyl]propanamide.
| Compound Name | 2-methyl-N-[3-[1-(3-phenylbut-3-enyl)piperidin-4-yl]phenyl]propanamide |
|---|---|
| PubChem CID | 142203721 |
| Molecular Formula | C25H32N2O |
| Molecular Weight | 376.54 g/mol |
| Exact Mass | 376.25 |
| IUPAC Name | 2-methyl-N-[3-[1-(3-phenylbut-3-enyl)piperidin-4-yl]phenyl]propanamide |
| SMILES | C=C(CCN1CCC(c2cccc(NC(=O)C(C)C)c2)CC1)c1ccccc1 |
| InChI | InChI=1S/C25H32N2O/c1-19(2)25(28)26-24-11-7-10-23(18-24)22-13-16-27(17-14-22)15-12-20(3)21-8-5-4-6-9-21/h4-11,18-19,22H,3,12-17H2,1-2H3,(H,26,28) |
| InChIKey | NNMMXNYIYYWPCB-UHFFFAOYSA-N |
| XLogP | 5.56 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.54 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |