C29H42N4OS — CID 58651275
N-[3-[1-[(3S)-3-(tert-butylcarbamothioylamino)-3-phenylpropyl]piperidin-4-yl]phenyl]-2-methylpropanamide (PubChem CID 58651275) has the molecular formula C29H42N4OS and a molecular weight of 494.75 g/mol. Its IUPAC name is N-[3-[1-[(3S)-3-(tert-butylcarbamothioylamino)-3-phenylpropyl]piperidin-4-yl]phenyl]-2-methylpropanamide.
| Compound Name | N-[3-[1-[(3S)-3-(tert-butylcarbamothioylamino)-3-phenylpropyl]piperidin-4-yl]phenyl]-2-methylpropanamide |
|---|---|
| PubChem CID | 58651275 |
| Molecular Formula | C29H42N4OS |
| Molecular Weight | 494.75 g/mol |
| Exact Mass | 494.31 |
| IUPAC Name | N-[3-[1-[(3S)-3-(tert-butylcarbamothioylamino)-3-phenylpropyl]piperidin-4-yl]phenyl]-2-methylpropanamide |
| SMILES | CC(C)C(=O)Nc1cccc(C2CCN(CC[C@H](NC(=S)NC(C)(C)C)c3ccccc3)CC2)c1 |
| InChI | InChI=1S/C29H42N4OS/c1-21(2)27(34)30-25-13-9-12-24(20-25)22-14-17-33(18-15-22)19-16-26(23-10-7-6-8-11-23)31-28(35)32-29(3,4)5/h6-13,20-22,26H,14-19H2,1-5H3,(H,30,34)(H2,31,32,35)/t26-/m0/s1 |
| InChIKey | YDEGABBQKJKIMM-SANMLTNESA-N |
| XLogP | 5.85 |
| TPSA | 56.40 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.75 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|